C25H31BN6O3 — CID 89304345
CID 89304345 (PubChem CID 89304345) has the molecular formula C25H31BN6O3 and a molecular weight of 474.37 g/mol.
| Compound Name | CID 89304345 |
|---|---|
| PubChem CID | 89304345 |
| Molecular Formula | C25H31BN6O3 |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | — |
| SMILES | [B]c1cc(-c2nc(N3CC4CN(C(=O)OC(C)(C)C)CC4C3)nc3c2ncn3CC)ccc1OC |
| InChI | InChI=1S/C25H31BN6O3/c1-6-30-14-27-21-20(15-7-8-19(34-5)18(26)9-15)28-23(29-22(21)30)31-10-16-12-32(13-17(16)11-31)24(33)35-25(2,3)4/h7-9,14,16-17H,6,10-13H2,1-5H3 |
| InChIKey | KSXFNJGDEJXAEN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|