C19H24N6O2 — CID 89287921
3-[[6-(2-aminophenyl)-9-(oxan-2-yl)purin-2-yl]amino]propan-1-ol (PubChem CID 89287921) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 3-[[6-(2-aminophenyl)-9-(oxan-2-yl)purin-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[6-(2-aminophenyl)-9-(oxan-2-yl)purin-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 89287921 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 3-[[6-(2-aminophenyl)-9-(oxan-2-yl)purin-2-yl]amino]propan-1-ol |
| SMILES | Nc1ccccc1-c1nc(NCCCO)nc2c1ncn2C1CCCCO1 |
| InChI | InChI=1S/C19H24N6O2/c20-14-7-2-1-6-13(14)16-17-18(24-19(23-16)21-9-5-10-26)25(12-22-17)15-8-3-4-11-27-15/h1-2,6-7,12,15,26H,3-5,8-11,20H2,(H,21,23,24) |
| InChIKey | IGHDVVIXFQLPOH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|