C14H18I2N6O — CID 123311479
1,2-diiodopropane;2-isocyano-9-(oxan-2-yl)purin-6-amine (PubChem CID 123311479) has the molecular formula C14H18I2N6O and a molecular weight of 540.15 g/mol. Its IUPAC name is 1,2-diiodopropane;2-isocyano-9-(oxan-2-yl)purin-6-amine.
| Compound Name | 1,2-diiodopropane;2-isocyano-9-(oxan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 123311479 |
| Molecular Formula | C14H18I2N6O |
| Molecular Weight | 540.15 g/mol |
| Exact Mass | 539.96 |
| IUPAC Name | 1,2-diiodopropane;2-isocyano-9-(oxan-2-yl)purin-6-amine |
| SMILES | CC(I)CI.[C-]#[N+]c1nc(N)c2ncn(C3CCCCO3)c2n1 |
| InChI | InChI=1S/C11H12N6O.C3H6I2/c1-13-11-15-9(12)8-10(16-11)17(6-14-8)7-4-2-3-5-18-7;1-3(5)2-4/h6-7H,2-5H2,(H2,12,15,16);3H,2H2,1H3 |
| InChIKey | KAHNWOMEHQUTFC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.15 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|