C18H34N6 — CID 162010980
3-methyl-4,5-di(propan-2-yl)-1,2,4-triazole (PubChem CID 162010980) has the molecular formula C18H34N6 and a molecular weight of 334.51 g/mol. Its IUPAC name is 3-methyl-4,5-di(propan-2-yl)-1,2,4-triazole.
| Compound Name | 3-methyl-4,5-di(propan-2-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 162010980 |
| Molecular Formula | C18H34N6 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.28 |
| IUPAC Name | 3-methyl-4,5-di(propan-2-yl)-1,2,4-triazole |
| SMILES | Cc1nnc(C(C)C)n1C(C)C.Cc1nnc(C(C)C)n1C(C)C |
| InChI | InChI=1S/2C9H17N3/c2*1-6(2)9-11-10-8(5)12(9)7(3)4/h2*6-7H,1-5H3 |
| InChIKey | YTLUDNCVKZXPFP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |