C5H7F2N3 — CID 118614370
4-(difluoromethyl)-3,5-dimethyl-1,2,4-triazole (PubChem CID 118614370) has the molecular formula C5H7F2N3 and a molecular weight of 147.13 g/mol. Its IUPAC name is 4-(difluoromethyl)-3,5-dimethyl-1,2,4-triazole.
| Compound Name | 4-(difluoromethyl)-3,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 118614370 |
| Molecular Formula | C5H7F2N3 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | 4-(difluoromethyl)-3,5-dimethyl-1,2,4-triazole |
| SMILES | Cc1nnc(C)n1C(F)F |
| InChI | InChI=1S/C5H7F2N3/c1-3-8-9-4(2)10(3)5(6)7/h5H,1-2H3 |
| InChIKey | SHDSMDVYWVAJER-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |