About 1-(difluoromethyl)-2,5-dimethylpyrrole
1-(difluoromethyl)-2,5-dimethylpyrrole (PubChem CID 146323567) has the molecular formula C7H9F2N
and a molecular weight of 145.15 g/mol. Its IUPAC name is 1-(difluoromethyl)-2,5-dimethylpyrrole.
Molecular Properties
| Compound Name | 1-(difluoromethyl)-2,5-dimethylpyrrole |
| PubChem CID | 146323567 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 1-(difluoromethyl)-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1C(F)F |
| InChI | InChI=1S/C7H9F2N/c1-5-3-4-6(2)10(5)7(8)9/h3-4,7H,1-2H3 |
| InChIKey | KHZCIMICIJZBIO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(difluoromethyl)-2,5-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethyl)-2,5-dimethylpyrrole?
The IUPAC name of 1-(difluoromethyl)-2,5-dimethylpyrrole (CID 146323567) is 1-(difluoromethyl)-2,5-dimethylpyrrole.
What is the SMILES notation for 1-(difluoromethyl)-2,5-dimethylpyrrole?
The canonical SMILES for 1-(difluoromethyl)-2,5-dimethylpyrrole is Cc1ccc(C)n1C(F)F.
What is the InChIKey of 1-(difluoromethyl)-2,5-dimethylpyrrole?
The InChIKey is KHZCIMICIJZBIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2N/c1-5-3-4-6(2)10(5)7(8)9/h3-4,7H,1-2H3.
What are the key properties of 1-(difluoromethyl)-2,5-dimethylpyrrole?
1-(difluoromethyl)-2,5-dimethylpyrrole has a molecular weight of 145.15 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethyl)-2,5-dimethylpyrrole is sourced from PubChem (CID 146323567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).