C14H24N2 — CID 176827560
5-tert-butyl-2,4-di(propan-2-yl)pyrimidine (PubChem CID 176827560) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 5-tert-butyl-2,4-di(propan-2-yl)pyrimidine.
| Compound Name | 5-tert-butyl-2,4-di(propan-2-yl)pyrimidine |
|---|---|
| PubChem CID | 176827560 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 5-tert-butyl-2,4-di(propan-2-yl)pyrimidine |
| SMILES | CC(C)c1ncc(C(C)(C)C)c(C(C)C)n1 |
| InChI | InChI=1S/C14H24N2/c1-9(2)12-11(14(5,6)7)8-15-13(16-12)10(3)4/h8-10H,1-7H3 |
| InChIKey | SCDPHOKFEZJEAV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |