C10H21NS — CID 142062830
ethane;4-propan-2-yl-1,2-thiazole (PubChem CID 142062830) has the molecular formula C10H21NS and a molecular weight of 187.35 g/mol. Its IUPAC name is ethane;4-propan-2-yl-1,2-thiazole.
| Compound Name | ethane;4-propan-2-yl-1,2-thiazole |
|---|---|
| PubChem CID | 142062830 |
| Molecular Formula | C10H21NS |
| Molecular Weight | 187.35 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | ethane;4-propan-2-yl-1,2-thiazole |
| SMILES | CC.CC.CC(C)c1cnsc1 |
| InChI | InChI=1S/C6H9NS.2C2H6/c1-5(2)6-3-7-8-4-6;2*1-2/h3-5H,1-2H3;2*1-2H3 |
| InChIKey | MMCRWPYDXZBIQH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |