C5H8N2OS — CID 117230048
1-(1,2-thiazol-4-yloxy)ethanamine (PubChem CID 117230048) has the molecular formula C5H8N2OS and a molecular weight of 144.20 g/mol. Its IUPAC name is 1-(1,2-thiazol-4-yloxy)ethanamine.
| Compound Name | 1-(1,2-thiazol-4-yloxy)ethanamine |
|---|---|
| PubChem CID | 117230048 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 1-(1,2-thiazol-4-yloxy)ethanamine |
| SMILES | CC(N)Oc1cnsc1 |
| InChI | InChI=1S/C5H8N2OS/c1-4(6)8-5-2-7-9-3-5/h2-4H,6H2,1H3 |
| InChIKey | WPJHRTAYTKCXOP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|