C7H11NOS — CID 117233613
4-(2-methylpropoxy)-1,2-thiazole (PubChem CID 117233613) has the molecular formula C7H11NOS and a molecular weight of 157.24 g/mol. Its IUPAC name is 4-(2-methylpropoxy)-1,2-thiazole.
| Compound Name | 4-(2-methylpropoxy)-1,2-thiazole |
|---|---|
| PubChem CID | 117233613 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 4-(2-methylpropoxy)-1,2-thiazole |
| SMILES | CC(C)COc1cnsc1 |
| InChI | InChI=1S/C7H11NOS/c1-6(2)4-9-7-3-8-10-5-7/h3,5-6H,4H2,1-2H3 |
| InChIKey | KRIMTFFRIRZJIO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |