About 4-undecan-5-yl-1,2-thiazole
4-undecan-5-yl-1,2-thiazole (PubChem CID 146406991) has the molecular formula C14H25NS
and a molecular weight of 239.43 g/mol. Its IUPAC name is 4-undecan-5-yl-1,2-thiazole.
Molecular Properties
| Compound Name | 4-undecan-5-yl-1,2-thiazole |
| PubChem CID | 146406991 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 4-undecan-5-yl-1,2-thiazole |
| SMILES | CCCCCCC(CCCC)c1cnsc1 |
| InChI | InChI=1S/C14H25NS/c1-3-5-7-8-10-13(9-6-4-2)14-11-15-16-12-14/h11-13H,3-10H2,1-2H3 |
| InChIKey | IZPMGZDPZGONTB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-undecan-5-yl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-undecan-5-yl-1,2-thiazole?
The IUPAC name of 4-undecan-5-yl-1,2-thiazole (CID 146406991) is 4-undecan-5-yl-1,2-thiazole.
What is the SMILES notation for 4-undecan-5-yl-1,2-thiazole?
The canonical SMILES for 4-undecan-5-yl-1,2-thiazole is CCCCCCC(CCCC)c1cnsc1.
What is the InChIKey of 4-undecan-5-yl-1,2-thiazole?
The InChIKey is IZPMGZDPZGONTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NS/c1-3-5-7-8-10-13(9-6-4-2)14-11-15-16-12-14/h11-13H,3-10H2,1-2H3.
What are the key properties of 4-undecan-5-yl-1,2-thiazole?
4-undecan-5-yl-1,2-thiazole has a molecular weight of 239.43 g/mol, XLogP of 5.39, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-undecan-5-yl-1,2-thiazole is sourced from PubChem (CID 146406991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).