C14H16F6N6O — CID 87464990
9-[[1-(1,1,1,5,5,5-hexafluoropentan-3-yloxy)cyclopropyl]methyl]purine-2,6-diamine (PubChem CID 87464990) has the molecular formula C14H16F6N6O and a molecular weight of 398.31 g/mol. Its IUPAC name is 9-[[1-(1,1,1,5,5,5-hexafluoropentan-3-yloxy)cyclopropyl]methyl]purine-2,6-diamine.
| Compound Name | 9-[[1-(1,1,1,5,5,5-hexafluoropentan-3-yloxy)cyclopropyl]methyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 87464990 |
| Molecular Formula | C14H16F6N6O |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 9-[[1-(1,1,1,5,5,5-hexafluoropentan-3-yloxy)cyclopropyl]methyl]purine-2,6-diamine |
| SMILES | Nc1nc(N)c2ncn(CC3(OC(CC(F)(F)F)CC(F)(F)F)CC3)c2n1 |
| InChI | InChI=1S/C14H16F6N6O/c15-13(16,17)3-7(4-14(18,19)20)27-12(1-2-12)5-26-6-23-8-9(21)24-11(22)25-10(8)26/h6-7H,1-5H2,(H4,21,22,24,25) |
| InChIKey | MUCSAYJZVMJOJB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |