C15H23ClN6O3 — CID 164881878
[4-(2-amino-6-chloropurin-9-yl)-2-methoxybutyl] 2-amino-3-methylbutanoate (PubChem CID 164881878) has the molecular formula C15H23ClN6O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is [4-(2-amino-6-chloropurin-9-yl)-2-methoxybutyl] 2-amino-3-methylbutanoate.
| Compound Name | [4-(2-amino-6-chloropurin-9-yl)-2-methoxybutyl] 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 164881878 |
| Molecular Formula | C15H23ClN6O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [4-(2-amino-6-chloropurin-9-yl)-2-methoxybutyl] 2-amino-3-methylbutanoate |
| SMILES | COC(CCn1cnc2c(Cl)nc(N)nc21)COC(=O)C(N)C(C)C |
| InChI | InChI=1S/C15H23ClN6O3/c1-8(2)10(17)14(23)25-6-9(24-3)4-5-22-7-19-11-12(16)20-15(18)21-13(11)22/h7-10H,4-6,17H2,1-3H3,(H2,18,20,21) |
| InChIKey | DORJKMNNEXHCDO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |