C15H24ClFN5OP — CID 57062350
6-chloro-9-[2-[di(propan-2-yl)phosphanylmethoxy]-3-fluoropropyl]purin-2-amine (PubChem CID 57062350) has the molecular formula C15H24ClFN5OP and a molecular weight of 375.82 g/mol. Its IUPAC name is 6-chloro-9-[2-[di(propan-2-yl)phosphanylmethoxy]-3-fluoropropyl]purin-2-amine.
| Compound Name | 6-chloro-9-[2-[di(propan-2-yl)phosphanylmethoxy]-3-fluoropropyl]purin-2-amine |
|---|---|
| PubChem CID | 57062350 |
| Molecular Formula | C15H24ClFN5OP |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 6-chloro-9-[2-[di(propan-2-yl)phosphanylmethoxy]-3-fluoropropyl]purin-2-amine |
| SMILES | CC(C)P(COC(CF)Cn1cnc2c(Cl)nc(N)nc21)C(C)C |
| InChI | InChI=1S/C15H24ClFN5OP/c1-9(2)24(10(3)4)8-23-11(5-17)6-22-7-19-12-13(16)20-15(18)21-14(12)22/h7,9-11H,5-6,8H2,1-4H3,(H2,18,20,21) |
| InChIKey | IWOBDBHCFRSQAA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|