C15H24FN8O3P — CID 57032218
6-azido-9-[2-[di(propan-2-yloxy)phosphanylmethoxy]-3-fluoropropyl]purin-2-amine (PubChem CID 57032218) has the molecular formula C15H24FN8O3P and a molecular weight of 414.38 g/mol. Its IUPAC name is 6-azido-9-[2-[di(propan-2-yloxy)phosphanylmethoxy]-3-fluoropropyl]purin-2-amine.
| Compound Name | 6-azido-9-[2-[di(propan-2-yloxy)phosphanylmethoxy]-3-fluoropropyl]purin-2-amine |
|---|---|
| PubChem CID | 57032218 |
| Molecular Formula | C15H24FN8O3P |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 6-azido-9-[2-[di(propan-2-yloxy)phosphanylmethoxy]-3-fluoropropyl]purin-2-amine |
| SMILES | CC(C)OP(COC(CF)Cn1cnc2c(N=[N+]=[N-])nc(N)nc21)OC(C)C |
| InChI | InChI=1S/C15H24FN8O3P/c1-9(2)26-28(27-10(3)4)8-25-11(5-16)6-24-7-19-12-13(22-23-18)20-15(17)21-14(12)24/h7,9-11H,5-6,8H2,1-4H3,(H2,17,20,21) |
| InChIKey | MMEOYOHURNNYMY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 146.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|