C19H16ClFN4O4S2 — CID 88525117
[(2R,3R,4R,5R)-5-(6-chloropurin-9-yl)-4-fluoro-3-methylsulfanylcarbothioyloxyoxolan-2-yl]methyl benzoate (PubChem CID 88525117) has the molecular formula C19H16ClFN4O4S2 and a molecular weight of 482.95 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-chloropurin-9-yl)-4-fluoro-3-methylsulfanylcarbothioyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-(6-chloropurin-9-yl)-4-fluoro-3-methylsulfanylcarbothioyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 88525117 |
| Molecular Formula | C19H16ClFN4O4S2 |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-chloropurin-9-yl)-4-fluoro-3-methylsulfanylcarbothioyloxyoxolan-2-yl]methyl benzoate |
| SMILES | CSC(=S)O[C@H]1[C@@H](F)[C@H](n2cnc3c(Cl)ncnc32)O[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16ClFN4O4S2/c1-31-19(30)29-14-11(7-27-18(26)10-5-3-2-4-6-10)28-17(12(14)21)25-9-24-13-15(20)22-8-23-16(13)25/h2-6,8-9,11-12,14,17H,7H2,1H3/t11-,12-,14-,17-/m1/s1 |
| InChIKey | BQSQOHICHPHYMW-CTWCOEIASA-N |
| XLogP | 3.61 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|