C11H11ClN4O3S — CID 22857236
ethyl (2S,5S)-5-(6-chloropurin-9-yl)-1,3-oxathiolane-2-carboxylate (PubChem CID 22857236) has the molecular formula C11H11ClN4O3S and a molecular weight of 314.75 g/mol. Its IUPAC name is ethyl (2S,5S)-5-(6-chloropurin-9-yl)-1,3-oxathiolane-2-carboxylate.
| Compound Name | ethyl (2S,5S)-5-(6-chloropurin-9-yl)-1,3-oxathiolane-2-carboxylate |
|---|---|
| PubChem CID | 22857236 |
| Molecular Formula | C11H11ClN4O3S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | ethyl (2S,5S)-5-(6-chloropurin-9-yl)-1,3-oxathiolane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1O[C@H](n2cnc3c(Cl)ncnc32)CS1 |
| InChI | InChI=1S/C11H11ClN4O3S/c1-2-18-10(17)11-19-6(3-20-11)16-5-15-7-8(12)13-4-14-9(7)16/h4-6,11H,2-3H2,1H3/t6-,11-/m0/s1 |
| InChIKey | RHHAZNUNCNHSGM-KGFZYKRKSA-N |
| XLogP | 1.63 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |