C9H7ClN4O3S — CID 22607104
5-(6-chloropurin-7-yl)-1,3-oxathiolane-2-carboxylic acid (PubChem CID 22607104) has the molecular formula C9H7ClN4O3S and a molecular weight of 286.70 g/mol. Its IUPAC name is 5-(6-chloropurin-7-yl)-1,3-oxathiolane-2-carboxylic acid.
| Compound Name | 5-(6-chloropurin-7-yl)-1,3-oxathiolane-2-carboxylic acid |
|---|---|
| PubChem CID | 22607104 |
| Molecular Formula | C9H7ClN4O3S |
| Molecular Weight | 286.70 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 5-(6-chloropurin-7-yl)-1,3-oxathiolane-2-carboxylic acid |
| SMILES | O=C(O)C1OC(n2cnc3ncnc(Cl)c32)CS1 |
| InChI | InChI=1S/C9H7ClN4O3S/c10-6-5-7(12-2-11-6)13-3-14(5)4-1-18-9(17-4)8(15)16/h2-4,9H,1H2,(H,15,16) |
| InChIKey | SOKMOXFVKJZHRS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.70 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |