C12H12FN3O8S — CID 68943049
(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carboxylic acid;(Z)-but-2-enedioic acid (PubChem CID 68943049) has the molecular formula C12H12FN3O8S and a molecular weight of 377.31 g/mol. Its IUPAC name is (2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carboxylic acid;(Z)-but-2-enedioic acid.
| Compound Name | (2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carboxylic acid;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 68943049 |
| Molecular Formula | C12H12FN3O8S |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | (2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carboxylic acid;(Z)-but-2-enedioic acid |
| SMILES | Nc1nc(=O)n([C@@H]2CS[C@H](C(=O)O)O2)cc1F.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C8H8FN3O4S.C4H4O4/c9-3-1-12(8(15)11-5(3)10)4-2-17-7(16-4)6(13)14;5-3(6)1-2-4(7)8/h1,4,7H,2H2,(H,13,14)(H2,10,11,15);1-2H,(H,5,6)(H,7,8)/b;2-1-/t4-,7+;/m0./s1 |
| InChIKey | HXZAQTBZBFXSFI-GFXPKZRTSA-N |
| XLogP | -0.65 |
| TPSA | 182.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|