About 6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine
6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine (PubChem CID 10428256) has the molecular formula C19H19ClN4O
and a molecular weight of 354.84 g/mol. Its IUPAC name is 6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine.
Molecular Properties
| Compound Name | 6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine |
| PubChem CID | 10428256 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine |
| SMILES | Clc1ncnc2ncn([C@H]3CC[C@]4(COCc5ccccc5)C[C@H]34)c12 |
| InChI | InChI=1S/C19H19ClN4O/c20-17-16-18(22-11-21-17)23-12-24(16)15-6-7-19(8-14(15)19)10-25-9-13-4-2-1-3-5-13/h1-5,11-12,14-15H,6-10H2/t14-,15+,19-/m1/s1 |
| InChIKey | KVTKGTXOABEKRY-ZRGWGRIASA-N |
| XLogP | 4.04 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine?
The IUPAC name of 6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine (CID 10428256) is 6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine.
What is the SMILES notation for 6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine?
The canonical SMILES for 6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine is Clc1ncnc2ncn([C@H]3CC[C@]4(COCc5ccccc5)C[C@H]34)c12.
What is the InChIKey of 6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine?
The InChIKey is KVTKGTXOABEKRY-ZRGWGRIASA-N. The full InChI is InChI=1S/C19H19ClN4O/c20-17-16-18(22-11-21-17)23-12-24(16)15-6-7-19(8-14(15)19)10-25-9-13-4-2-1-3-5-13/h1-5,11-12,14-15H,6-10H2/t14-,15+,19-/m1/s1.
What are the key properties of 6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine?
6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine has a molecular weight of 354.84 g/mol, XLogP of 4.04, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purine is sourced from PubChem (CID 10428256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).