C16H23N5O3 — CID 143062608
ethane;ethyl (E)-3-[5-(6-aminopurin-9-yl)oxolan-2-yl]prop-2-enoate (PubChem CID 143062608) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is ethane;ethyl (E)-3-[5-(6-aminopurin-9-yl)oxolan-2-yl]prop-2-enoate.
| Compound Name | ethane;ethyl (E)-3-[5-(6-aminopurin-9-yl)oxolan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 143062608 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | ethane;ethyl (E)-3-[5-(6-aminopurin-9-yl)oxolan-2-yl]prop-2-enoate |
| SMILES | CC.CCOC(=O)/C=C/C1CCC(n2cnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C14H17N5O3.C2H6/c1-2-21-11(20)6-4-9-3-5-10(22-9)19-8-18-12-13(15)16-7-17-14(12)19;1-2/h4,6-10H,2-3,5H2,1H3,(H2,15,16,17);1-2H3/b6-4+; |
| InChIKey | HPQHRSNUVOQINQ-CVDVRWGVSA-N |
| XLogP | 2.23 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|