C18H21F3N5O4PS — CID 24885154
1-[2-amino-6-(2-methoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxymethyl-(2,2,2-trifluoroethyl)phosphinic acid (PubChem CID 24885154) has the molecular formula C18H21F3N5O4PS and a molecular weight of 491.43 g/mol. Its IUPAC name is 1-[2-amino-6-(2-methoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxymethyl-(2,2,2-trifluoroethyl)phosphinic acid.
| Compound Name | 1-[2-amino-6-(2-methoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxymethyl-(2,2,2-trifluoroethyl)phosphinic acid |
|---|---|
| PubChem CID | 24885154 |
| Molecular Formula | C18H21F3N5O4PS |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 1-[2-amino-6-(2-methoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxymethyl-(2,2,2-trifluoroethyl)phosphinic acid |
| SMILES | COc1ccccc1Sc1nc(N)nc2c1ncn2CC(C)OCP(=O)(O)CC(F)(F)F |
| InChI | InChI=1S/C18H21F3N5O4PS/c1-11(30-10-31(27,28)8-18(19,20)21)7-26-9-23-14-15(26)24-17(22)25-16(14)32-13-6-4-3-5-12(13)29-2/h3-6,9,11H,7-8,10H2,1-2H3,(H,27,28)(H2,22,24,25) |
| InChIKey | CBVFPNDJPMDXCK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|