C18H19N5O2S — CID 10177135
8-(2,5-dimethoxyphenyl)sulfanyl-9-pent-4-ynylpurin-6-amine (PubChem CID 10177135) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is 8-(2,5-dimethoxyphenyl)sulfanyl-9-pent-4-ynylpurin-6-amine.
| Compound Name | 8-(2,5-dimethoxyphenyl)sulfanyl-9-pent-4-ynylpurin-6-amine |
|---|---|
| PubChem CID | 10177135 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 8-(2,5-dimethoxyphenyl)sulfanyl-9-pent-4-ynylpurin-6-amine |
| SMILES | C#CCCCn1c(Sc2cc(OC)ccc2OC)nc2c(N)ncnc21 |
| InChI | InChI=1S/C18H19N5O2S/c1-4-5-6-9-23-17-15(16(19)20-11-21-17)22-18(23)26-14-10-12(24-2)7-8-13(14)25-3/h1,7-8,10-11H,5-6,9H2,2-3H3,(H2,19,20,21) |
| InChIKey | COCHTDZHHBDUTK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|