C17H21N5O2S — CID 11574041
9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine (PubChem CID 11574041) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine.
| Compound Name | 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine |
|---|---|
| PubChem CID | 11574041 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine |
| SMILES | CCCCn1c(Sc2cc(OC)ccc2OC)nc2c(N)ncnc21 |
| InChI | InChI=1S/C17H21N5O2S/c1-4-5-8-22-16-14(15(18)19-10-20-16)21-17(22)25-13-9-11(23-2)6-7-12(13)24-3/h6-7,9-10H,4-5,8H2,1-3H3,(H2,18,19,20) |
| InChIKey | FPMBLCHVDGURBC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |