About 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine
9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine (PubChem CID 11574041) has the molecular formula C17H21N5O2S
and a molecular weight of 359.46 g/mol. Its IUPAC name is 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine.
Molecular Properties
| Compound Name | 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine |
| PubChem CID | 11574041 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine |
| SMILES | CCCCn1c(Sc2cc(OC)ccc2OC)nc2c(N)ncnc21 |
| InChI | InChI=1S/C17H21N5O2S/c1-4-5-8-22-16-14(15(18)19-10-20-16)21-17(22)25-13-9-11(23-2)6-7-12(13)24-3/h6-7,9-10H,4-5,8H2,1-3H3,(H2,18,19,20) |
| InChIKey | FPMBLCHVDGURBC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine?
The IUPAC name of 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine (CID 11574041) is 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine.
What is the SMILES notation for 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine?
The canonical SMILES for 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine is CCCCn1c(Sc2cc(OC)ccc2OC)nc2c(N)ncnc21.
What is the InChIKey of 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine?
The InChIKey is FPMBLCHVDGURBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5O2S/c1-4-5-8-22-16-14(15(18)19-10-20-16)21-17(22)25-13-9-11(23-2)6-7-12(13)24-3/h6-7,9-10H,4-5,8H2,1-3H3,(H2,18,19,20).
What are the key properties of 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine?
9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine has a molecular weight of 359.46 g/mol, XLogP of 3.38, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butyl-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine is sourced from PubChem (CID 11574041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).