C18H20IN5OS — CID 10277546
8-(2-iodo-5-methoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine (PubChem CID 10277546) has the molecular formula C18H20IN5OS and a molecular weight of 481.36 g/mol. Its IUPAC name is 8-(2-iodo-5-methoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine.
| Compound Name | 8-(2-iodo-5-methoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine |
|---|---|
| PubChem CID | 10277546 |
| Molecular Formula | C18H20IN5OS |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | 8-(2-iodo-5-methoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine |
| SMILES | COc1ccc(I)c(Sc2nc3c(N)ncnc3n2CCC=C(C)C)c1 |
| InChI | InChI=1S/C18H20IN5OS/c1-11(2)5-4-8-24-17-15(16(20)21-10-22-17)23-18(24)26-14-9-12(25-3)6-7-13(14)19/h5-7,9-10H,4,8H2,1-3H3,(H2,20,21,22) |
| InChIKey | WLTOIVIRGVHOAN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|