C17H14IN5O2S — CID 11677337
8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-9-pent-4-ynylpurin-6-amine (PubChem CID 11677337) has the molecular formula C17H14IN5O2S and a molecular weight of 479.30 g/mol. Its IUPAC name is 8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-9-pent-4-ynylpurin-6-amine.
| Compound Name | 8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-9-pent-4-ynylpurin-6-amine |
|---|---|
| PubChem CID | 11677337 |
| Molecular Formula | C17H14IN5O2S |
| Molecular Weight | 479.30 g/mol |
| Exact Mass | 478.99 |
| IUPAC Name | 8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-9-pent-4-ynylpurin-6-amine |
| SMILES | C#CCCCn1c(Sc2cc3c(cc2I)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C17H14IN5O2S/c1-2-3-4-5-23-16-14(15(19)20-8-21-16)22-17(23)26-13-7-12-11(6-10(13)18)24-9-25-12/h1,6-8H,3-5,9H2,(H2,19,20,21) |
| InChIKey | QSNAITKZUCGADX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|