C26H36IN7O4S — CID 175285876
6-[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propylamino]hexyl-tert-butylcarbamic acid (PubChem CID 175285876) has the molecular formula C26H36IN7O4S and a molecular weight of 669.59 g/mol. Its IUPAC name is 6-[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propylamino]hexyl-tert-butylcarbamic acid.
| Compound Name | 6-[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propylamino]hexyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 175285876 |
| Molecular Formula | C26H36IN7O4S |
| Molecular Weight | 669.59 g/mol |
| Exact Mass | 669.16 |
| IUPAC Name | 6-[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propylamino]hexyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(CCCCCCNCCCn1c(Sc2cc3c(cc2I)OCO3)nc2c(N)ncnc21)C(=O)O |
| InChI | InChI=1S/C26H36IN7O4S/c1-26(2,3)34(25(35)36)12-7-5-4-6-9-29-10-8-11-33-23-21(22(28)30-15-31-23)32-24(33)39-20-14-19-18(13-17(20)27)37-16-38-19/h13-15,29H,4-12,16H2,1-3H3,(H,35,36)(H2,28,30,31) |
| InChIKey | AQDRZBXYIFQDTG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|