C21H29N7O2S — CID 121353096
8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[4-(propan-2-ylamino)butyl]purin-6-amine (PubChem CID 121353096) has the molecular formula C21H29N7O2S and a molecular weight of 443.58 g/mol. Its IUPAC name is 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[4-(propan-2-ylamino)butyl]purin-6-amine.
| Compound Name | 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[4-(propan-2-ylamino)butyl]purin-6-amine |
|---|---|
| PubChem CID | 121353096 |
| Molecular Formula | C21H29N7O2S |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[4-(propan-2-ylamino)butyl]purin-6-amine |
| SMILES | CC(C)NCCCCn1c(Sc2cc3c(cc2N(C)C)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C21H29N7O2S/c1-13(2)23-7-5-6-8-28-20-18(19(22)24-11-25-20)26-21(28)31-17-10-16-15(29-12-30-16)9-14(17)27(3)4/h9-11,13,23H,5-8,12H2,1-4H3,(H2,22,24,25) |
| InChIKey | KFKNDACILSVEEA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|