C22H24N8O2S — CID 90085098
9-[4-(cyclopropylamino)butyl]-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine (PubChem CID 90085098) has the molecular formula C22H24N8O2S and a molecular weight of 464.56 g/mol. Its IUPAC name is 9-[4-(cyclopropylamino)butyl]-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine.
| Compound Name | 9-[4-(cyclopropylamino)butyl]-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 90085098 |
| Molecular Formula | C22H24N8O2S |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 9-[4-(cyclopropylamino)butyl]-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine |
| SMILES | Nc1ncnc2c1nc(Sc1cc3c(cc1-c1ccn[nH]1)OCO3)n2CCCCNC1CC1 |
| InChI | InChI=1S/C22H24N8O2S/c23-20-19-21(26-11-25-20)30(8-2-1-6-24-13-3-4-13)22(28-19)33-18-10-17-16(31-12-32-17)9-14(18)15-5-7-27-29-15/h5,7,9-11,13,24H,1-4,6,8,12H2,(H,27,29)(H2,23,25,26) |
| InChIKey | QFOOBSJCDMFZEN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|