C23H26N6O3S — CID 121353047
8-[[6-(furan-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]-9-[4-(propan-2-ylamino)butyl]purin-6-amine (PubChem CID 121353047) has the molecular formula C23H26N6O3S and a molecular weight of 466.57 g/mol. Its IUPAC name is 8-[[6-(furan-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]-9-[4-(propan-2-ylamino)butyl]purin-6-amine.
| Compound Name | 8-[[6-(furan-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]-9-[4-(propan-2-ylamino)butyl]purin-6-amine |
|---|---|
| PubChem CID | 121353047 |
| Molecular Formula | C23H26N6O3S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 8-[[6-(furan-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]-9-[4-(propan-2-ylamino)butyl]purin-6-amine |
| SMILES | CC(C)NCCCCn1c(Sc2cc3c(cc2-c2ccco2)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C23H26N6O3S/c1-14(2)25-7-3-4-8-29-22-20(21(24)26-12-27-22)28-23(29)33-19-11-18-17(31-13-32-18)10-15(19)16-6-5-9-30-16/h5-6,9-12,14,25H,3-4,7-8,13H2,1-2H3,(H2,24,26,27) |
| InChIKey | FMFCHKZOTOODOL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|