C19H23IN6O2S — CID 90364119
8-[(6-(131I)iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine (PubChem CID 90364119) has the molecular formula C19H23IN6O2S and a molecular weight of 530.41 g/mol. Its IUPAC name is 8-[(6-(131I)iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine.
| Compound Name | 8-[(6-(131I)iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
|---|---|
| PubChem CID | 90364119 |
| Molecular Formula | C19H23IN6O2S |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | 8-[(6-(131I)iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
| SMILES | CC(C)NCCCn1c(Sc2cc3c(cc2[131I])OCCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C19H23IN6O2S/c1-11(2)22-4-3-5-26-18-16(17(21)23-10-24-18)25-19(26)29-15-9-14-13(8-12(15)20)27-6-7-28-14/h8-11,22H,3-7H2,1-2H3,(H2,21,23,24)/i20+4 |
| InChIKey | OGVPPEHQZFHZET-URWOLLDTSA-N |
| XLogP | 3.32 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|