C20H25IN6O2S — CID 121353238
8-[(6-iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]-9-[2-(3-methylbutylamino)ethyl]purin-6-amine (PubChem CID 121353238) has the molecular formula C20H25IN6O2S and a molecular weight of 540.43 g/mol. Its IUPAC name is 8-[(6-iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]-9-[2-(3-methylbutylamino)ethyl]purin-6-amine.
| Compound Name | 8-[(6-iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]-9-[2-(3-methylbutylamino)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 121353238 |
| Molecular Formula | C20H25IN6O2S |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 8-[(6-iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]-9-[2-(3-methylbutylamino)ethyl]purin-6-amine |
| SMILES | CC(C)CCNCCn1c(Sc2cc3c(cc2I)OCCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C20H25IN6O2S/c1-12(2)3-4-23-5-6-27-19-17(18(22)24-11-25-19)26-20(27)30-16-10-15-14(9-13(16)21)28-7-8-29-15/h9-12,23H,3-8H2,1-2H3,(H2,22,24,25) |
| InChIKey | UVICJLKTMSUDQM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|