C20H23IN6S2 — CID 122668054
6-[6-amino-9-[2-(2-methylpropylamino)ethyl]purin-8-yl]sulfanyl-5-iodo-2,3-dihydroindene-1-thione (PubChem CID 122668054) has the molecular formula C20H23IN6S2 and a molecular weight of 538.48 g/mol. Its IUPAC name is 6-[6-amino-9-[2-(2-methylpropylamino)ethyl]purin-8-yl]sulfanyl-5-iodo-2,3-dihydroindene-1-thione.
| Compound Name | 6-[6-amino-9-[2-(2-methylpropylamino)ethyl]purin-8-yl]sulfanyl-5-iodo-2,3-dihydroindene-1-thione |
|---|---|
| PubChem CID | 122668054 |
| Molecular Formula | C20H23IN6S2 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | 6-[6-amino-9-[2-(2-methylpropylamino)ethyl]purin-8-yl]sulfanyl-5-iodo-2,3-dihydroindene-1-thione |
| SMILES | CC(C)CNCCn1c(Sc2cc3c(cc2I)CCC3=S)nc2c(N)ncnc21 |
| InChI | InChI=1S/C20H23IN6S2/c1-11(2)9-23-5-6-27-19-17(18(22)24-10-25-19)26-20(27)29-16-8-13-12(7-14(16)21)3-4-15(13)28/h7-8,10-11,23H,3-6,9H2,1-2H3,(H2,22,24,25) |
| InChIKey | GYNZCMPPAAIVND-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|