C22H28FIN6S — CID 121353209
8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]-9-[4-(2-methylpropylamino)butyl]purin-6-amine (PubChem CID 121353209) has the molecular formula C22H28FIN6S and a molecular weight of 554.48 g/mol. Its IUPAC name is 8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]-9-[4-(2-methylpropylamino)butyl]purin-6-amine.
| Compound Name | 8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]-9-[4-(2-methylpropylamino)butyl]purin-6-amine |
|---|---|
| PubChem CID | 121353209 |
| Molecular Formula | C22H28FIN6S |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | 8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]-9-[4-(2-methylpropylamino)butyl]purin-6-amine |
| SMILES | CC(C)CNCCCCn1c(Sc2cc3c(cc2I)CCC3F)nc2c(N)ncnc21 |
| InChI | InChI=1S/C22H28FIN6S/c1-13(2)11-26-7-3-4-8-30-21-19(20(25)27-12-28-21)29-22(30)31-18-10-15-14(9-17(18)24)5-6-16(15)23/h9-10,12-13,16,26H,3-8,11H2,1-2H3,(H2,25,27,28) |
| InChIKey | PREQOZUEFBHZSF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|