C16H16FIN6S — CID 90072561
9-(2-aminoethyl)-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-6-amine (PubChem CID 90072561) has the molecular formula C16H16FIN6S and a molecular weight of 470.32 g/mol. Its IUPAC name is 9-(2-aminoethyl)-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-6-amine.
| Compound Name | 9-(2-aminoethyl)-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 90072561 |
| Molecular Formula | C16H16FIN6S |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 9-(2-aminoethyl)-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-6-amine |
| SMILES | NCCn1c(Sc2cc3c(cc2I)CCC3F)nc2c(N)ncnc21 |
| InChI | InChI=1S/C16H16FIN6S/c17-10-2-1-8-5-11(18)12(6-9(8)10)25-16-23-13-14(20)21-7-22-15(13)24(16)4-3-19/h5-7,10H,1-4,19H2,(H2,20,21,22) |
| InChIKey | YFBKKDLUKFVJOP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|