C18H18FIN6OS — CID 90072792
N-[2-[6-amino-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-9-yl]ethyl]acetamide (PubChem CID 90072792) has the molecular formula C18H18FIN6OS and a molecular weight of 512.35 g/mol. Its IUPAC name is N-[2-[6-amino-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-9-yl]ethyl]acetamide.
| Compound Name | N-[2-[6-amino-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-9-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 90072792 |
| Molecular Formula | C18H18FIN6OS |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | N-[2-[6-amino-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-9-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCn1c(Sc2cc3c(cc2I)CCC3F)nc2c(N)ncnc21 |
| InChI | InChI=1S/C18H18FIN6OS/c1-9(27)22-4-5-26-17-15(16(21)23-8-24-17)25-18(26)28-14-7-11-10(6-13(14)20)2-3-12(11)19/h6-8,12H,2-5H2,1H3,(H,22,27)(H2,21,23,24) |
| InChIKey | RKUXTLAXQQAOME-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|