C18H17IN6O2S — CID 90073092
N-[2-[6-amino-8-[(6-iodo-3-oxo-1,2-dihydroinden-5-yl)sulfanyl]purin-9-yl]ethyl]acetamide (PubChem CID 90073092) has the molecular formula C18H17IN6O2S and a molecular weight of 508.35 g/mol. Its IUPAC name is N-[2-[6-amino-8-[(6-iodo-3-oxo-1,2-dihydroinden-5-yl)sulfanyl]purin-9-yl]ethyl]acetamide.
| Compound Name | N-[2-[6-amino-8-[(6-iodo-3-oxo-1,2-dihydroinden-5-yl)sulfanyl]purin-9-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 90073092 |
| Molecular Formula | C18H17IN6O2S |
| Molecular Weight | 508.35 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | N-[2-[6-amino-8-[(6-iodo-3-oxo-1,2-dihydroinden-5-yl)sulfanyl]purin-9-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCn1c(Sc2cc3c(cc2I)CCC3=O)nc2c(N)ncnc21 |
| InChI | InChI=1S/C18H17IN6O2S/c1-9(26)21-4-5-25-17-15(16(20)22-8-23-17)24-18(25)28-14-7-11-10(6-12(14)19)2-3-13(11)27/h6-8H,2-5H2,1H3,(H,21,26)(H2,20,22,23) |
| InChIKey | CSOWVPSDFBNKJK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|