C20H24FIN6S — CID 121353198
8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine (PubChem CID 121353198) has the molecular formula C20H24FIN6S and a molecular weight of 526.42 g/mol. Its IUPAC name is 8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine.
| Compound Name | 8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 121353198 |
| Molecular Formula | C20H24FIN6S |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | 8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine |
| SMILES | CC(C)CNCCn1c(Sc2cc3c(cc2I)CCC3F)nc2c(N)ncnc21 |
| InChI | InChI=1S/C20H24FIN6S/c1-11(2)9-24-5-6-28-19-17(18(23)25-10-26-19)27-20(28)29-16-8-13-12(7-15(16)22)3-4-14(13)21/h7-8,10-11,14,24H,3-6,9H2,1-2H3,(H2,23,25,26) |
| InChIKey | YNIBPFZAECKQDR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|