C19H21IN6O2S — CID 121353232
9-[2-(cyclopropylmethylamino)ethyl]-8-[(6-iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]purin-6-amine (PubChem CID 121353232) has the molecular formula C19H21IN6O2S and a molecular weight of 524.39 g/mol. Its IUPAC name is 9-[2-(cyclopropylmethylamino)ethyl]-8-[(6-iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]purin-6-amine.
| Compound Name | 9-[2-(cyclopropylmethylamino)ethyl]-8-[(6-iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 121353232 |
| Molecular Formula | C19H21IN6O2S |
| Molecular Weight | 524.39 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | 9-[2-(cyclopropylmethylamino)ethyl]-8-[(6-iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]purin-6-amine |
| SMILES | Nc1ncnc2c1nc(Sc1cc3c(cc1I)OCCO3)n2CCNCC1CC1 |
| InChI | InChI=1S/C19H21IN6O2S/c20-12-7-13-14(28-6-5-27-13)8-15(12)29-19-25-16-17(21)23-10-24-18(16)26(19)4-3-22-9-11-1-2-11/h7-8,10-11,22H,1-6,9H2,(H2,21,23,24) |
| InChIKey | WAJBFSASVKOTBP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|