C19H21IN6O3S — CID 122667860
6-[6-amino-8-[(6-iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]purin-9-yl]hexanamide (PubChem CID 122667860) has the molecular formula C19H21IN6O3S and a molecular weight of 540.39 g/mol. Its IUPAC name is 6-[6-amino-8-[(6-iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]purin-9-yl]hexanamide.
| Compound Name | 6-[6-amino-8-[(6-iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]purin-9-yl]hexanamide |
|---|---|
| PubChem CID | 122667860 |
| Molecular Formula | C19H21IN6O3S |
| Molecular Weight | 540.39 g/mol |
| Exact Mass | 540.04 |
| IUPAC Name | 6-[6-amino-8-[(6-iodo-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]purin-9-yl]hexanamide |
| SMILES | NC(=O)CCCCCn1c(Sc2cc3c(cc2I)OCCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C19H21IN6O3S/c20-11-8-12-13(29-7-6-28-12)9-14(11)30-19-25-16-17(22)23-10-24-18(16)26(19)5-3-1-2-4-15(21)27/h8-10H,1-7H2,(H2,21,27)(H2,22,23,24) |
| InChIKey | CGQWMGYBTWOAPZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|