C17H14N6O3S — CID 90073357
3-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propanamide (PubChem CID 90073357) has the molecular formula C17H14N6O3S and a molecular weight of 382.41 g/mol. Its IUPAC name is 3-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propanamide.
| Compound Name | 3-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propanamide |
|---|---|
| PubChem CID | 90073357 |
| Molecular Formula | C17H14N6O3S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 3-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propanamide |
| SMILES | C#Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCC(N)=O)OCO2 |
| InChI | InChI=1S/C17H14N6O3S/c1-2-9-5-10-11(26-8-25-10)6-12(9)27-17-22-14-15(19)20-7-21-16(14)23(17)4-3-13(18)24/h1,5-7H,3-4,8H2,(H2,18,24)(H2,19,20,21) |
| InChIKey | BJKRBQDIIBXXAN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|