C19H20N7O4S2- — CID 123937591
6-amino-8-[(7-ethynyl-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]-9-[2-[2-(sulfinatoamino)ethylamino]ethyl]purine (PubChem CID 123937591) has the molecular formula C19H20N7O4S2- and a molecular weight of 474.55 g/mol. Its IUPAC name is 6-amino-8-[(7-ethynyl-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]-9-[2-[2-(sulfinatoamino)ethylamino]ethyl]purine.
| Compound Name | 6-amino-8-[(7-ethynyl-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]-9-[2-[2-(sulfinatoamino)ethylamino]ethyl]purine |
|---|---|
| PubChem CID | 123937591 |
| Molecular Formula | C19H20N7O4S2- |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 6-amino-8-[(7-ethynyl-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]-9-[2-[2-(sulfinatoamino)ethylamino]ethyl]purine |
| SMILES | C#Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCNCCNS(=O)[O-])OCCO2 |
| InChI | InChI=1S/C19H21N7O4S2/c1-2-12-9-13-14(30-8-7-29-13)10-15(12)31-19-25-16-17(20)22-11-23-18(16)26(19)6-5-21-3-4-24-32(27)28/h1,9-11,21,24H,3-8H2,(H,27,28)(H2,20,22,23)/p-1 |
| InChIKey | KEJBCXBMHYLPCV-UHFFFAOYSA-M |
| XLogP | 0.29 |
| TPSA | 152.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|