C20H18N6O4S2 — CID 122513023
N-[3-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]cyclopropene-1-sulfonamide (PubChem CID 122513023) has the molecular formula C20H18N6O4S2 and a molecular weight of 470.54 g/mol. Its IUPAC name is N-[3-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]cyclopropene-1-sulfonamide.
| Compound Name | N-[3-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]cyclopropene-1-sulfonamide |
|---|---|
| PubChem CID | 122513023 |
| Molecular Formula | C20H18N6O4S2 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | N-[3-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]cyclopropene-1-sulfonamide |
| SMILES | C#Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCCNS(=O)(=O)C1=CC1)OCO2 |
| InChI | InChI=1S/C20H18N6O4S2/c1-2-12-8-14-15(30-11-29-14)9-16(12)31-20-25-17-18(21)22-10-23-19(17)26(20)7-3-6-24-32(27,28)13-4-5-13/h1,4,8-10,24H,3,5-7,11H2,(H2,21,22,23) |
| InChIKey | XLAZXHGRAICBEX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|