C17H16N6O2S — CID 87274785
9-(3-aminopropyl)-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine (PubChem CID 87274785) has the molecular formula C17H16N6O2S and a molecular weight of 368.42 g/mol. Its IUPAC name is 9-(3-aminopropyl)-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine.
| Compound Name | 9-(3-aminopropyl)-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 87274785 |
| Molecular Formula | C17H16N6O2S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 9-(3-aminopropyl)-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine |
| SMILES | C#Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCCN)OCO2 |
| InChI | InChI=1S/C17H16N6O2S/c1-2-10-6-11-12(25-9-24-11)7-13(10)26-17-22-14-15(19)20-8-21-16(14)23(17)5-3-4-18/h1,6-8H,3-5,9,18H2,(H2,19,20,21) |
| InChIKey | QQHIGNMBSRXHTL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|