C21H24N6O3S — CID 87274900
1-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]-3-(tert-butylamino)propan-2-ol (PubChem CID 87274900) has the molecular formula C21H24N6O3S and a molecular weight of 440.53 g/mol. Its IUPAC name is 1-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]-3-(tert-butylamino)propan-2-ol.
| Compound Name | 1-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]-3-(tert-butylamino)propan-2-ol |
|---|---|
| PubChem CID | 87274900 |
| Molecular Formula | C21H24N6O3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]-3-(tert-butylamino)propan-2-ol |
| SMILES | C#Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CC(O)CNC(C)(C)C)OCO2 |
| InChI | InChI=1S/C21H24N6O3S/c1-5-12-6-14-15(30-11-29-14)7-16(12)31-20-26-17-18(22)23-10-24-19(17)27(20)9-13(28)8-25-21(2,3)4/h1,6-7,10,13,25,28H,8-9,11H2,2-4H3,(H2,22,23,24) |
| InChIKey | KYOBNLDHDNGDTP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|