C21H22N6O3S — CID 90073015
N-[2-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethyl]-2,2-dimethylpropanamide (PubChem CID 90073015) has the molecular formula C21H22N6O3S and a molecular weight of 438.51 g/mol. Its IUPAC name is N-[2-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 90073015 |
| Molecular Formula | C21H22N6O3S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-[2-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethyl]-2,2-dimethylpropanamide |
| SMILES | C#Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCNC(=O)C(C)(C)C)OCO2 |
| InChI | InChI=1S/C21H22N6O3S/c1-5-12-8-13-14(30-11-29-13)9-15(12)31-20-26-16-17(22)24-10-25-18(16)27(20)7-6-23-19(28)21(2,3)4/h1,8-10H,6-7,11H2,2-4H3,(H,23,28)(H2,22,24,25) |
| InChIKey | GOLLCTQYZBSMOK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|