C16H14N6O2S — CID 87274714
9-(2-aminoethyl)-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine (PubChem CID 87274714) has the molecular formula C16H14N6O2S and a molecular weight of 354.40 g/mol. Its IUPAC name is 9-(2-aminoethyl)-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine.
| Compound Name | 9-(2-aminoethyl)-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 87274714 |
| Molecular Formula | C16H14N6O2S |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 9-(2-aminoethyl)-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine |
| SMILES | C#Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCN)OCO2 |
| InChI | InChI=1S/C16H14N6O2S/c1-2-9-5-10-11(24-8-23-10)6-12(9)25-16-21-13-14(18)19-7-20-15(13)22(16)4-3-17/h1,5-7H,3-4,8,17H2,(H2,18,19,20) |
| InChIKey | YMCCRIPIFPZVNP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|