C19H19N7O3S — CID 121353024
9-(4-aminobutyl)-8-[[6-(1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine (PubChem CID 121353024) has the molecular formula C19H19N7O3S and a molecular weight of 425.47 g/mol. Its IUPAC name is 9-(4-aminobutyl)-8-[[6-(1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine.
| Compound Name | 9-(4-aminobutyl)-8-[[6-(1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 121353024 |
| Molecular Formula | C19H19N7O3S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 9-(4-aminobutyl)-8-[[6-(1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine |
| SMILES | NCCCCn1c(Sc2cc3c(cc2-c2ncco2)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C19H19N7O3S/c20-3-1-2-5-26-17-15(16(21)23-9-24-17)25-19(26)30-14-8-13-12(28-10-29-13)7-11(14)18-22-4-6-27-18/h4,6-9H,1-3,5,10,20H2,(H2,21,23,24) |
| InChIKey | XPKQHTIVTFJVAH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 140.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|