C20H20N6O5S2 — CID 70855611
N-[3-[6-amino-8-[[6-(furan-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]methanesulfonamide (PubChem CID 70855611) has the molecular formula C20H20N6O5S2 and a molecular weight of 488.55 g/mol. Its IUPAC name is N-[3-[6-amino-8-[[6-(furan-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[6-amino-8-[[6-(furan-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 70855611 |
| Molecular Formula | C20H20N6O5S2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | N-[3-[6-amino-8-[[6-(furan-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCn1c(Sc2cc3c(cc2-c2ccco2)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C20H20N6O5S2/c1-33(27,28)24-5-3-6-26-19-17(18(21)22-10-23-19)25-20(26)32-16-9-15-14(30-11-31-15)8-12(16)13-4-2-7-29-13/h2,4,7-10,24H,3,5-6,11H2,1H3,(H2,21,22,23) |
| InChIKey | VVFUWQCEQUAKNS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 147.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|