C19H25N7O4S2 — CID 70855810
3-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]-N-ethylpropane-1-sulfonamide (PubChem CID 70855810) has the molecular formula C19H25N7O4S2 and a molecular weight of 479.59 g/mol. Its IUPAC name is 3-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]-N-ethylpropane-1-sulfonamide.
| Compound Name | 3-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]-N-ethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 70855810 |
| Molecular Formula | C19H25N7O4S2 |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 3-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]-N-ethylpropane-1-sulfonamide |
| SMILES | CCNS(=O)(=O)CCCn1c(Sc2cc3c(cc2N(C)C)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C19H25N7O4S2/c1-4-23-32(27,28)7-5-6-26-18-16(17(20)21-10-22-18)24-19(26)31-15-9-14-13(29-11-30-14)8-12(15)25(2)3/h8-10,23H,4-7,11H2,1-3H3,(H2,20,21,22) |
| InChIKey | WJXZIPATIAVBLL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|